C21H26FN7O — CID 174033534
2-[6-[[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]-methylamino]-1,2,4-triazin-3-yl]-5-(1-methyl-1,2,4-triazol-3-yl)phenol (PubChem CID 174033534) has the molecular formula C21H26FN7O and a molecular weight of 411.49 g/mol. Its IUPAC name is 2-[6-[[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]-methylamino]-1,2,4-triazin-3-yl]-5-(1-methyl-1,2,4-triazol-3-yl)phenol.
| Compound Name | 2-[6-[[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]-methylamino]-1,2,4-triazin-3-yl]-5-(1-methyl-1,2,4-triazol-3-yl)phenol |
|---|---|
| PubChem CID | 174033534 |
| Molecular Formula | C21H26FN7O |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-[6-[[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]-methylamino]-1,2,4-triazin-3-yl]-5-(1-methyl-1,2,4-triazol-3-yl)phenol |
| SMILES | CC[C@@H]1CC[C@H](F)[C@H](N(C)c2cnc(-c3ccc(-c4ncn(C)n4)cc3O)nn2)C1 |
| InChI | InChI=1S/C21H26FN7O/c1-4-13-5-8-16(22)17(9-13)29(3)19-11-23-21(26-25-19)15-7-6-14(10-18(15)30)20-24-12-28(2)27-20/h6-7,10-13,16-17,30H,4-5,8-9H2,1-3H3/t13-,16+,17-/m1/s1 |
| InChIKey | GAQIKVRZSBWMIN-XOKHGSTOSA-N |
| XLogP | 3.39 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |