C26H30FN5O2 — CID 174033651
5-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-7-yl)-2-[6-[[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]-methylamino]-1,2,4-triazin-3-yl]phenol (PubChem CID 174033651) has the molecular formula C26H30FN5O2 and a molecular weight of 463.56 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-7-yl)-2-[6-[[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]-methylamino]-1,2,4-triazin-3-yl]phenol.
| Compound Name | 5-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-7-yl)-2-[6-[[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]-methylamino]-1,2,4-triazin-3-yl]phenol |
|---|---|
| PubChem CID | 174033651 |
| Molecular Formula | C26H30FN5O2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 5-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-7-yl)-2-[6-[[(1R,2S,5R)-5-ethyl-2-fluorocyclohexyl]-methylamino]-1,2,4-triazin-3-yl]phenol |
| SMILES | CC[C@@H]1CC[C@H](F)[C@H](N(C)c2cnc(-c3ccc(-c4cnc5c(c4)OCCC5)cc3O)nn2)C1 |
| InChI | InChI=1S/C26H30FN5O2/c1-3-16-6-9-20(27)22(11-16)32(2)25-15-29-26(31-30-25)19-8-7-17(12-23(19)33)18-13-24-21(28-14-18)5-4-10-34-24/h7-8,12-16,20,22,33H,3-6,9-11H2,1-2H3/t16-,20+,22-/m1/s1 |
| InChIKey | KDBKLQBQSQNPBR-QGCDCVKKSA-N |
| XLogP | 4.98 |
| TPSA | 84.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |