C25H27F2N5O2S3 — CID 167305547
2-[6-[[(1S,2R,3S,5R)-2-fluoro-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol (PubChem CID 167305547) has the molecular formula C25H27F2N5O2S3 and a molecular weight of 563.72 g/mol. Its IUPAC name is 2-[6-[[(1S,2R,3S,5R)-2-fluoro-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol.
| Compound Name | 2-[6-[[(1S,2R,3S,5R)-2-fluoro-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 167305547 |
| Molecular Formula | C25H27F2N5O2S3 |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 2-[6-[[(1S,2R,3S,5R)-2-fluoro-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol |
| SMILES | CN(c1cnc(-c2ccc(-c3cc(OC(S)(S)S)ncc3F)cc2O)nn1)[C@H]1C[C@@H]2CCC[C@@H](C2)[C@H]1F |
| InChI | InChI=1S/C25H27F2N5O2S3/c1-32(19-8-13-3-2-4-15(7-13)23(19)27)21-12-29-24(31-30-21)16-6-5-14(9-20(16)33)17-10-22(28-11-18(17)26)34-25(35,36)37/h5-6,9-13,15,19,23,33,35-37H,2-4,7-8H2,1H3/t13-,15+,19+,23-/m1/s1 |
| InChIKey | KRODFLHNPVRBPP-ISJXTJTLSA-N |
| XLogP | 5.58 |
| TPSA | 84.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|