C23H24F2N6O2 — CID 167305412
2-[6-[[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-6-methoxy-3-pyridinyl)phenol (PubChem CID 167305412) has the molecular formula C23H24F2N6O2 and a molecular weight of 454.48 g/mol. Its IUPAC name is 2-[6-[[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-6-methoxy-3-pyridinyl)phenol.
| Compound Name | 2-[6-[[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-6-methoxy-3-pyridinyl)phenol |
|---|---|
| PubChem CID | 167305412 |
| Molecular Formula | C23H24F2N6O2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-[6-[[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-6-methoxy-3-pyridinyl)phenol |
| SMILES | COc1ncc(-c2ccc(-c3ncc(N(C)[C@H]4C[C@@H]5CC[C@@H](N5)[C@H]4F)nn3)c(O)c2)cc1F |
| InChI | InChI=1S/C23H24F2N6O2/c1-31(18-9-14-4-6-17(28-14)21(18)25)20-11-26-22(30-29-20)15-5-3-12(8-19(15)32)13-7-16(24)23(33-2)27-10-13/h3,5,7-8,10-11,14,17-18,21,28,32H,4,6,9H2,1-2H3/t14-,17+,18-,21+/m0/s1 |
| InChIKey | SAAZVBBVJKEWDA-ASTRLGPVSA-N |
| XLogP | 3.12 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |