C27H31F2N5O2S3 — CID 167305576
2-[6-[[(1R,2S,3R,5S)-2-fluoro-1,5-dimethyl-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol (PubChem CID 167305576) has the molecular formula C27H31F2N5O2S3 and a molecular weight of 591.78 g/mol. Its IUPAC name is 2-[6-[[(1R,2S,3R,5S)-2-fluoro-1,5-dimethyl-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol.
| Compound Name | 2-[6-[[(1R,2S,3R,5S)-2-fluoro-1,5-dimethyl-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 167305576 |
| Molecular Formula | C27H31F2N5O2S3 |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 2-[6-[[(1R,2S,3R,5S)-2-fluoro-1,5-dimethyl-3-bicyclo[3.3.1]nonanyl]-methylamino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-[tris(sulfanyl)methoxy]-4-pyridinyl]phenol |
| SMILES | CN(c1cnc(-c2ccc(-c3cc(OC(S)(S)S)ncc3F)cc2O)nn1)[C@@H]1C[C@@]2(C)CCC[C@](C)(C2)[C@@H]1F |
| InChI | InChI=1S/C27H31F2N5O2S3/c1-25-7-4-8-26(2,14-25)23(29)19(11-25)34(3)21-13-31-24(33-32-21)16-6-5-15(9-20(16)35)17-10-22(30-12-18(17)28)36-27(37,38)39/h5-6,9-10,12-13,19,23,35,37-39H,4,7-8,11,14H2,1-3H3/t19-,23-,25-,26-/m1/s1 |
| InChIKey | SBXMCDHRNFJZNZ-KYTRFIICSA-N |
| XLogP | 6.36 |
| TPSA | 84.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|