C25H30FN7O2 — CID 166580644
2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(6-methoxypyridazin-4-yl)phenol (PubChem CID 166580644) has the molecular formula C25H30FN7O2 and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(6-methoxypyridazin-4-yl)phenol.
| Compound Name | 2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(6-methoxypyridazin-4-yl)phenol |
|---|---|
| PubChem CID | 166580644 |
| Molecular Formula | C25H30FN7O2 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[6-[[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(6-methoxypyridazin-4-yl)phenol |
| SMILES | COc1cc(-c2ccc(-c3ncc(N(C)[C@@H]4C[C@@]5(C)CCC[C@](C)(N5)[C@@H]4F)nn3)c(O)c2)cnn1 |
| InChI | InChI=1S/C25H30FN7O2/c1-24-8-5-9-25(2,32-24)22(26)18(12-24)33(3)20-14-27-23(31-29-20)17-7-6-15(10-19(17)34)16-11-21(35-4)30-28-13-16/h6-7,10-11,13-14,18,22,32,34H,5,8-9,12H2,1-4H3/t18-,22-,24-,25+/m1/s1 |
| InChIKey | JOAMZIGIMFEMDK-KGEBQXBDSA-N |
| XLogP | 3.55 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |