C26H30F2N6OS — CID 166580048
2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-2-methylsulfanyl-4-pyridinyl)phenol (PubChem CID 166580048) has the molecular formula C26H30F2N6OS and a molecular weight of 512.63 g/mol. Its IUPAC name is 2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-2-methylsulfanyl-4-pyridinyl)phenol.
| Compound Name | 2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-2-methylsulfanyl-4-pyridinyl)phenol |
|---|---|
| PubChem CID | 166580048 |
| Molecular Formula | C26H30F2N6OS |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-5-(5-fluoro-2-methylsulfanyl-4-pyridinyl)phenol |
| SMILES | CSc1cc(-c2ccc(-c3ncc(N(C)[C@H]4C[C@]5(C)CCC[C@@](C)(N5)[C@H]4F)nn3)c(O)c2)c(F)cn1 |
| InChI | InChI=1S/C26H30F2N6OS/c1-25-8-5-9-26(2,33-25)23(28)19(12-25)34(3)21-14-30-24(32-31-21)16-7-6-15(10-20(16)35)17-11-22(36-4)29-13-18(17)27/h6-7,10-11,13-14,19,23,33,35H,5,8-9,12H2,1-4H3/t19-,23-,25-,26+/m0/s1 |
| InChIKey | SRZRNHGJTISKNW-QMCNGJBUSA-N |
| XLogP | 5.00 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |