C24H29FN8O — CID 167302063
2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(1-methyl-1,2,4-triazol-3-yl)phenol (PubChem CID 167302063) has the molecular formula C24H29FN8O and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(1-methyl-1,2,4-triazol-3-yl)phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(1-methyl-1,2,4-triazol-3-yl)phenol |
|---|---|
| PubChem CID | 167302063 |
| Molecular Formula | C24H29FN8O |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(1-methyl-1,2,4-triazol-3-yl)phenol |
| SMILES | Cn1cnc(-c2ccc(-c3ncc(N(C4CC4)[C@@H]4C[C@H]5CCC[C@](C)(N5)[C@@H]4F)nn3)c(O)c2)n1 |
| InChI | InChI=1S/C24H29FN8O/c1-24-9-3-4-15(28-24)11-18(21(24)25)33(16-6-7-16)20-12-26-23(30-29-20)17-8-5-14(10-19(17)34)22-27-13-32(2)31-22/h5,8,10,12-13,15-16,18,21,28,34H,3-4,6-7,9,11H2,1-2H3/t15-,18-,21-,24+/m1/s1 |
| InChIKey | AYKAWFFJMRHVMT-PKJNMOSASA-N |
| XLogP | 3.02 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |