C21H26FN9O — CID 166580261
2-[6-[[(1S,2R,3R,5S)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-(trideuteriomethyl)amino]-1,2,4-triazin-3-yl]-5-[2-(trideuteriomethyl)tetrazol-5-yl]phenol (PubChem CID 166580261) has the molecular formula C21H26FN9O and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[6-[[(1S,2R,3R,5S)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-(trideuteriomethyl)amino]-1,2,4-triazin-3-yl]-5-[2-(trideuteriomethyl)tetrazol-5-yl]phenol.
| Compound Name | 2-[6-[[(1S,2R,3R,5S)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-(trideuteriomethyl)amino]-1,2,4-triazin-3-yl]-5-[2-(trideuteriomethyl)tetrazol-5-yl]phenol |
|---|---|
| PubChem CID | 166580261 |
| Molecular Formula | C21H26FN9O |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 2-[6-[[(1S,2R,3R,5S)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-(trideuteriomethyl)amino]-1,2,4-triazin-3-yl]-5-[2-(trideuteriomethyl)tetrazol-5-yl]phenol |
| SMILES | [2H]C([2H])([2H])N(c1cnc(-c2ccc(-c3nnn(C([2H])([2H])[2H])n3)cc2O)nn1)[C@@H]1C[C@@H]2CCC[C@](C)(N2)[C@@H]1F |
| InChI | InChI=1S/C21H26FN9O/c1-21-8-4-5-13(24-21)10-15(18(21)22)30(2)17-11-23-20(26-25-17)14-7-6-12(9-16(14)32)19-27-29-31(3)28-19/h6-7,9,11,13,15,18,24,32H,4-5,8,10H2,1-3H3/t13-,15+,18+,21-/m0/s1/i2D3,3D3 |
| InChIKey | UYXYNJBFIOQILR-XITQSLSYSA-N |
| XLogP | 1.88 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |