C26H35FN8OS3 — CID 167302053
2-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluoro-3,7-dimethylcyclooctyl]amino]-1,2,4-triazin-3-yl]-5-[2-[tris(sulfanyl)methyl]tetrazol-5-yl]phenol (PubChem CID 167302053) has the molecular formula C26H35FN8OS3 and a molecular weight of 590.82 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluoro-3,7-dimethylcyclooctyl]amino]-1,2,4-triazin-3-yl]-5-[2-[tris(sulfanyl)methyl]tetrazol-5-yl]phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluoro-3,7-dimethylcyclooctyl]amino]-1,2,4-triazin-3-yl]-5-[2-[tris(sulfanyl)methyl]tetrazol-5-yl]phenol |
|---|---|
| PubChem CID | 167302053 |
| Molecular Formula | C26H35FN8OS3 |
| Molecular Weight | 590.82 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluoro-3,7-dimethylcyclooctyl]amino]-1,2,4-triazin-3-yl]-5-[2-[tris(sulfanyl)methyl]tetrazol-5-yl]phenol |
| SMILES | CC[C@]1(C)CCCC(C)C[C@H](N(c2cnc(-c3ccc(-c4nnn(C(S)(S)S)n4)cc3O)nn2)C2CC2)[C@@H]1F |
| InChI | InChI=1S/C26H35FN8OS3/c1-4-25(3)11-5-6-15(2)12-19(22(25)27)34(17-8-9-17)21-14-28-24(30-29-21)18-10-7-16(13-20(18)36)23-31-33-35(32-23)26(37,38)39/h7,10,13-15,17,19,22,36-39H,4-6,8-9,11-12H2,1-3H3/t15?,19-,22-,25+/m0/s1 |
| InChIKey | QDMLQHIRSVGGTR-MPKURMBDSA-N |
| XLogP | 5.56 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.82 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|