C23H24FN7OS — CID 174033271
5-[4-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 174033271) has the molecular formula C23H24FN7OS and a molecular weight of 465.56 g/mol. Its IUPAC name is 5-[4-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-[4-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 174033271 |
| Molecular Formula | C23H24FN7OS |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 5-[4-[6-[cyclopropyl-[(1S,2R,3R)-3-ethyl-2-fluorocyclohexyl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | CC[C@@H]1CCC[C@H](N(c2cnc(-c3ccc(-c4nnc(C#N)s4)cc3O)nn2)C2CC2)[C@@H]1F |
| InChI | InChI=1S/C23H24FN7OS/c1-2-13-4-3-5-17(21(13)24)31(15-7-8-15)19-12-26-22(29-27-19)16-9-6-14(10-18(16)32)23-30-28-20(11-25)33-23/h6,9-10,12-13,15,17,21,32H,2-5,7-8H2,1H3/t13-,17+,21-/m1/s1 |
| InChIKey | VOTYNBMLCWSHPM-GQNMWPQZSA-N |
| XLogP | 4.52 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |