C23H22FN7OS — CID 166581074
2-[4-[6-[cyclopropyl-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-4-carbonitrile (PubChem CID 166581074) has the molecular formula C23H22FN7OS and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[4-[6-[cyclopropyl-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-4-carbonitrile.
| Compound Name | 2-[4-[6-[cyclopropyl-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 166581074 |
| Molecular Formula | C23H22FN7OS |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[4-[6-[cyclopropyl-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-4-carbonitrile |
| SMILES | N#Cc1csc(-c2ccc(-c3ncc(N(C4CC4)[C@H]4C[C@H]5CC[C@H](N5)[C@H]4F)nn3)c(O)c2)n1 |
| InChI | InChI=1S/C23H22FN7OS/c24-21-17-6-2-13(27-17)8-18(21)31(15-3-4-15)20-10-26-22(30-29-20)16-5-1-12(7-19(16)32)23-28-14(9-25)11-33-23/h1,5,7,10-11,13,15,17-18,21,27,32H,2-4,6,8H2/t13-,17+,18+,21-/m1/s1 |
| InChIKey | UDEJCWLEMNJYCI-HTRFZCGXSA-N |
| XLogP | 3.44 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |