C25H26F2N6O2 — CID 166581143
4-[4-[6-[cyclopropyl-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-6-fluoro-1-methylpyridin-2-one (PubChem CID 166581143) has the molecular formula C25H26F2N6O2 and a molecular weight of 480.52 g/mol. Its IUPAC name is 4-[4-[6-[cyclopropyl-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-6-fluoro-1-methylpyridin-2-one.
| Compound Name | 4-[4-[6-[cyclopropyl-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-6-fluoro-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 166581143 |
| Molecular Formula | C25H26F2N6O2 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 4-[4-[6-[cyclopropyl-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-6-fluoro-1-methylpyridin-2-one |
| SMILES | Cn1c(F)cc(-c2ccc(-c3ncc(N(C4CC4)[C@H]4C[C@H]5CC[C@H](N5)[C@H]4F)nn3)c(O)c2)cc1=O |
| InChI | InChI=1S/C25H26F2N6O2/c1-32-21(26)9-14(10-23(32)35)13-2-6-17(20(34)8-13)25-28-12-22(30-31-25)33(16-4-5-16)19-11-15-3-7-18(29-15)24(19)27/h2,6,8-10,12,15-16,18-19,24,29,34H,3-5,7,11H2,1H3/t15-,18+,19+,24-/m1/s1 |
| InChIKey | QIQLDYDVYRSNFA-JVNPVLLESA-N |
| XLogP | 2.95 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|