C28H32N6O3 — CID 167301862
2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-yl)phenol (PubChem CID 167301862) has the molecular formula C28H32N6O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-yl)phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-yl)phenol |
|---|---|
| PubChem CID | 167301862 |
| Molecular Formula | C28H32N6O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1S,5R)-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-yl)phenol |
| SMILES | C[C@]12CC[C@](C)(CC(N(c3cnc(-c4ccc(-c5cnc6c(c5)OCCO6)cc4O)nn3)C3CC3)C1)N2 |
| InChI | InChI=1S/C28H32N6O3/c1-27-7-8-28(2,33-27)14-20(13-27)34(19-4-5-19)24-16-29-25(32-31-24)21-6-3-17(11-22(21)35)18-12-23-26(30-15-18)37-10-9-36-23/h3,6,11-12,15-16,19-20,33,35H,4-5,7-10,13-14H2,1-2H3/t20?,27-,28+ |
| InChIKey | RIGQWXJRUVMIFI-KGPDTDBQSA-N |
| XLogP | 4.11 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |