C26H29F2N7O2 — CID 166580779
4-[4-[6-[cyclopropyl-[(1R,3R,4S,5R)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-6-fluoro-1-methylpyrimidin-2-one (PubChem CID 166580779) has the molecular formula C26H29F2N7O2 and a molecular weight of 509.56 g/mol. Its IUPAC name is 4-[4-[6-[cyclopropyl-[(1R,3R,4S,5R)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-6-fluoro-1-methylpyrimidin-2-one.
| Compound Name | 4-[4-[6-[cyclopropyl-[(1R,3R,4S,5R)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-6-fluoro-1-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 166580779 |
| Molecular Formula | C26H29F2N7O2 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 4-[4-[6-[cyclopropyl-[(1R,3R,4S,5R)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-6-fluoro-1-methylpyrimidin-2-one |
| SMILES | Cn1c(F)cc(-c2ccc(-c3ncc(N(C4CC4)[C@@H]4C[C@@]5(C)CCC[C@@H](N5)[C@@H]4F)nn3)c(O)c2)nc1=O |
| InChI | InChI=1S/C26H29F2N7O2/c1-26-9-3-4-17(31-26)23(28)19(12-26)35(15-6-7-15)22-13-29-24(33-32-22)16-8-5-14(10-20(16)36)18-11-21(27)34(2)25(37)30-18/h5,8,10-11,13,15,17,19,23,31,36H,3-4,6-7,9,12H2,1-2H3/t17-,19-,23+,26-/m1/s1 |
| InChIKey | YIQSPXZCPROTNR-KWQNWTKRSA-N |
| XLogP | 3.12 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |