C24H28FN7O2 — CID 167369748
4-[4-[6-[[(1R,3R,4S,5S)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one (PubChem CID 167369748) has the molecular formula C24H28FN7O2 and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-[4-[6-[[(1R,3R,4S,5S)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one.
| Compound Name | 4-[4-[6-[[(1R,3R,4S,5S)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 167369748 |
| Molecular Formula | C24H28FN7O2 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 4-[4-[6-[[(1R,3R,4S,5S)-4-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
| SMILES | CN(c1ccc(-c2ccc(-c3ncn(C)c(=O)n3)cc2O)nn1)[C@@H]1C[C@@]2(C)CCC[C@H](N2)[C@@H]1F |
| InChI | InChI=1S/C24H28FN7O2/c1-24-10-4-5-17(28-24)21(25)18(12-24)32(3)20-9-8-16(29-30-20)15-7-6-14(11-19(15)33)22-26-13-31(2)23(34)27-22/h6-9,11,13,17-18,21,28,33H,4-5,10,12H2,1-3H3/t17-,18+,21-,24+/m0/s1 |
| InChIKey | IARMUCUOGQQJPS-OPNQQPSUSA-N |
| XLogP | 2.45 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |