C26H29FN6O2 — CID 167369702
4-[4-[6-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]ethenyl]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one (PubChem CID 167369702) has the molecular formula C26H29FN6O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is 4-[4-[6-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]ethenyl]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one.
| Compound Name | 4-[4-[6-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]ethenyl]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 167369702 |
| Molecular Formula | C26H29FN6O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-[4-[6-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]ethenyl]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
| SMILES | C=C(c1ccc(-c2ccc(-c3ncn(C)c(=O)n3)cc2O)nn1)[C@@H]1C[C@@]2(C)CCC[C@](C)(N2)[C@@H]1F |
| InChI | InChI=1S/C26H29FN6O2/c1-15(18-13-25(2)10-5-11-26(3,32-25)22(18)27)19-8-9-20(31-30-19)17-7-6-16(12-21(17)34)23-28-14-33(4)24(35)29-23/h6-9,12,14,18,22,32,34H,1,5,10-11,13H2,2-4H3/t18-,22+,25+,26-/m0/s1 |
| InChIKey | JMNSUUQBAXNEPY-RLXGTLHVSA-N |
| XLogP | 3.67 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |