C25H29FN6O3 — CID 167370258
4-[4-[6-[[(1S,2S,3R,5R)-2-fluoro-1,5,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl]oxy]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one (PubChem CID 167370258) has the molecular formula C25H29FN6O3 and a molecular weight of 480.54 g/mol. Its IUPAC name is 4-[4-[6-[[(1S,2S,3R,5R)-2-fluoro-1,5,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl]oxy]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one.
| Compound Name | 4-[4-[6-[[(1S,2S,3R,5R)-2-fluoro-1,5,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl]oxy]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 167370258 |
| Molecular Formula | C25H29FN6O3 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 4-[4-[6-[[(1S,2S,3R,5R)-2-fluoro-1,5,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl]oxy]pyridazin-3-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
| SMILES | CN1[C@]2(C)CCC[C@@]1(C)[C@H](F)[C@H](Oc1ccc(-c3ccc(-c4ncn(C)c(=O)n4)cc3O)nn1)C2 |
| InChI | InChI=1S/C25H29FN6O3/c1-24-10-5-11-25(2,32(24)4)21(26)19(13-24)35-20-9-8-17(29-30-20)16-7-6-15(12-18(16)33)22-27-14-31(3)23(34)28-22/h6-9,12,14,19,21,33H,5,10-11,13H2,1-4H3/t19-,21-,24-,25+/m1/s1 |
| InChIKey | PAZIJQWNSBUWKH-PPZUDANNSA-N |
| XLogP | 3.13 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |