C21H23FN6O3S — CID 167368726
4-[4-[5-[[(1R,4R,5S,6R)-6-fluoro-1,2-dimethyl-2-azabicyclo[2.2.2]octan-5-yl]oxy]-1,3,4-thiadiazol-2-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one (PubChem CID 167368726) has the molecular formula C21H23FN6O3S and a molecular weight of 458.52 g/mol. Its IUPAC name is 4-[4-[5-[[(1R,4R,5S,6R)-6-fluoro-1,2-dimethyl-2-azabicyclo[2.2.2]octan-5-yl]oxy]-1,3,4-thiadiazol-2-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one.
| Compound Name | 4-[4-[5-[[(1R,4R,5S,6R)-6-fluoro-1,2-dimethyl-2-azabicyclo[2.2.2]octan-5-yl]oxy]-1,3,4-thiadiazol-2-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 167368726 |
| Molecular Formula | C21H23FN6O3S |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4-[4-[5-[[(1R,4R,5S,6R)-6-fluoro-1,2-dimethyl-2-azabicyclo[2.2.2]octan-5-yl]oxy]-1,3,4-thiadiazol-2-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
| SMILES | CN1C[C@H]2CC[C@]1(C)[C@@H](F)[C@H]2Oc1nnc(-c2ccc(-c3ncn(C)c(=O)n3)cc2O)s1 |
| InChI | InChI=1S/C21H23FN6O3S/c1-21-7-6-12(9-28(21)3)15(16(21)22)31-20-26-25-18(32-20)13-5-4-11(8-14(13)29)17-23-10-27(2)19(30)24-17/h4-5,8,10,12,15-16,29H,6-7,9H2,1-3H3/t12-,15+,16+,21-/m1/s1 |
| InChIKey | GFTYEIPAYNDKHV-JNTBSDPJSA-N |
| XLogP | 2.27 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |