C24H28FN7O2 — CID 167369930
2-[6-[[(1S,5S,6S)-6-fluoro-1,2-dimethyl-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]pyridazin-3-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol (PubChem CID 167369930) has the molecular formula C24H28FN7O2 and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-[6-[[(1S,5S,6S)-6-fluoro-1,2-dimethyl-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]pyridazin-3-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol.
| Compound Name | 2-[6-[[(1S,5S,6S)-6-fluoro-1,2-dimethyl-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]pyridazin-3-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol |
|---|---|
| PubChem CID | 167369930 |
| Molecular Formula | C24H28FN7O2 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 2-[6-[[(1S,5S,6S)-6-fluoro-1,2-dimethyl-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]pyridazin-3-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol |
| SMILES | COc1ncnc(-c2ccc(-c3ccc(N(C)[C@H]4C5CC[C@@](C)([C@H]4F)N(C)C5)nn3)c(O)c2)n1 |
| InChI | InChI=1S/C24H28FN7O2/c1-24-10-9-15(12-31(24)2)20(21(24)25)32(3)19-8-7-17(29-30-19)16-6-5-14(11-18(16)33)22-26-13-27-23(28-22)34-4/h5-8,11,13,15,20-21,33H,9-10,12H2,1-4H3/t15?,20-,21-,24-/m0/s1 |
| InChIKey | RYWOKBRAMLMCOB-CTBUIHGMSA-N |
| XLogP | 2.97 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |