C23H26N6O3 — CID 167370075
2-[6-[[(1R,3S,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]pyridazin-3-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol (PubChem CID 167370075) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[6-[[(1R,3S,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]pyridazin-3-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol.
| Compound Name | 2-[6-[[(1R,3S,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]pyridazin-3-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol |
|---|---|
| PubChem CID | 167370075 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[6-[[(1R,3S,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]pyridazin-3-yl]-5-(4-methoxy-1,3,5-triazin-2-yl)phenol |
| SMILES | COc1ncnc(-c2ccc(-c3ccc(O[C@H]4C[C@@H]5CC[C@](C)(C4)N5C)nn3)c(O)c2)n1 |
| InChI | InChI=1S/C23H26N6O3/c1-23-9-8-15(29(23)2)11-16(12-23)32-20-7-6-18(27-28-20)17-5-4-14(10-19(17)30)21-24-13-25-22(26-21)31-3/h4-7,10,13,15-16,30H,8-9,11-12H2,1-3H3/t15-,16-,23+/m0/s1 |
| InChIKey | HJCLRTCACWXACC-PBPSECFOSA-N |
| XLogP | 3.10 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |