C23H26N4O3S — CID 167369189
2-[5-[[(1R,3S,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-(2-methoxy-4-pyridinyl)phenol (PubChem CID 167369189) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-[5-[[(1R,3S,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-(2-methoxy-4-pyridinyl)phenol.
| Compound Name | 2-[5-[[(1R,3S,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-(2-methoxy-4-pyridinyl)phenol |
|---|---|
| PubChem CID | 167369189 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[5-[[(1R,3S,5S)-1,8-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-1,3,4-thiadiazol-2-yl]-5-(2-methoxy-4-pyridinyl)phenol |
| SMILES | COc1cc(-c2ccc(-c3nnc(O[C@H]4C[C@@H]5CC[C@](C)(C4)N5C)s3)c(O)c2)ccn1 |
| InChI | InChI=1S/C23H26N4O3S/c1-23-8-6-16(27(23)2)12-17(13-23)30-22-26-25-21(31-22)18-5-4-14(10-19(18)28)15-7-9-24-20(11-15)29-3/h4-5,7,9-11,16-17,28H,6,8,12-13H2,1-3H3/t16-,17-,23+/m0/s1 |
| InChIKey | APRBRVNLVUGQGA-HKARXFIJSA-N |
| XLogP | 4.38 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |