C20H22FN7O2S — CID 167369187
4-[4-[5-[[(5R,6R)-6-fluoro-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]-1,3,4-thiadiazol-2-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one (PubChem CID 167369187) has the molecular formula C20H22FN7O2S and a molecular weight of 443.51 g/mol. Its IUPAC name is 4-[4-[5-[[(5R,6R)-6-fluoro-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]-1,3,4-thiadiazol-2-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one.
| Compound Name | 4-[4-[5-[[(5R,6R)-6-fluoro-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]-1,3,4-thiadiazol-2-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 167369187 |
| Molecular Formula | C20H22FN7O2S |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-[4-[5-[[(5R,6R)-6-fluoro-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]-1,3,4-thiadiazol-2-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
| SMILES | CN(c1nnc(-c2ccc(-c3ncn(C)c(=O)n3)cc2O)s1)[C@@H]1C2CCC(NC2)[C@H]1F |
| InChI | InChI=1S/C20H22FN7O2S/c1-27-9-23-17(24-19(27)30)10-3-5-12(14(29)7-10)18-25-26-20(31-18)28(2)16-11-4-6-13(15(16)21)22-8-11/h3,5,7,9,11,13,15-16,22,29H,4,6,8H2,1-2H3/t11?,13?,15-,16-/m1/s1 |
| InChIKey | UYSZFIGEHQLESG-MOBWVJJFSA-N |
| XLogP | 1.59 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |