C24H29FN6O2 — CID 167369292
2-[6-[[(1S,2S,3R,5R)-2-fluoro-1,5,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl]oxy]pyridazin-3-yl]-5-(4-methyltriazol-2-yl)phenol (PubChem CID 167369292) has the molecular formula C24H29FN6O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 2-[6-[[(1S,2S,3R,5R)-2-fluoro-1,5,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl]oxy]pyridazin-3-yl]-5-(4-methyltriazol-2-yl)phenol.
| Compound Name | 2-[6-[[(1S,2S,3R,5R)-2-fluoro-1,5,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl]oxy]pyridazin-3-yl]-5-(4-methyltriazol-2-yl)phenol |
|---|---|
| PubChem CID | 167369292 |
| Molecular Formula | C24H29FN6O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[6-[[(1S,2S,3R,5R)-2-fluoro-1,5,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl]oxy]pyridazin-3-yl]-5-(4-methyltriazol-2-yl)phenol |
| SMILES | Cc1cnn(-c2ccc(-c3ccc(O[C@@H]4C[C@@]5(C)CCC[C@@](C)([C@@H]4F)N5C)nn3)c(O)c2)n1 |
| InChI | InChI=1S/C24H29FN6O2/c1-15-14-26-31(29-15)16-6-7-17(19(32)12-16)18-8-9-21(28-27-18)33-20-13-23(2)10-5-11-24(3,22(20)25)30(23)4/h6-9,12,14,20,22,32H,5,10-11,13H2,1-4H3/t20-,22-,23-,24+/m1/s1 |
| InChIKey | BQDFLGSWIQMEHJ-BUZMGHMJSA-N |
| XLogP | 3.86 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |