C23H28FN7O — CID 166586378
2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5,8-trimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]pyridazin-3-yl]-5-(1,2,4-triazol-4-yl)phenol (PubChem CID 166586378) has the molecular formula C23H28FN7O and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5,8-trimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]pyridazin-3-yl]-5-(1,2,4-triazol-4-yl)phenol.
| Compound Name | 2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5,8-trimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]pyridazin-3-yl]-5-(1,2,4-triazol-4-yl)phenol |
|---|---|
| PubChem CID | 166586378 |
| Molecular Formula | C23H28FN7O |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5,8-trimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]pyridazin-3-yl]-5-(1,2,4-triazol-4-yl)phenol |
| SMILES | CN(c1ccc(-c2ccc(-n3cnnc3)cc2O)nn1)[C@H]1C[C@]2(C)CC[C@](C)([C@H]1F)N2C |
| InChI | InChI=1S/C23H28FN7O/c1-22-9-10-23(2,30(22)4)21(24)18(12-22)29(3)20-8-7-17(27-28-20)16-6-5-15(11-19(16)32)31-13-25-26-14-31/h5-8,11,13-14,18,21,32H,9-10,12H2,1-4H3/t18-,21-,22-,23+/m0/s1 |
| InChIKey | DAIIMCYBQFPCLY-FDTGPBLFSA-N |
| XLogP | 3.22 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |