C22H24FN7O — CID 166586731
2-[6-[[(1R,3S,4S,5R)-4-fluoro-1,8-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]pyridazin-3-yl]-5-(1,2,4-triazol-4-yl)phenol (PubChem CID 166586731) has the molecular formula C22H24FN7O and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-[6-[[(1R,3S,4S,5R)-4-fluoro-1,8-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]pyridazin-3-yl]-5-(1,2,4-triazol-4-yl)phenol.
| Compound Name | 2-[6-[[(1R,3S,4S,5R)-4-fluoro-1,8-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]pyridazin-3-yl]-5-(1,2,4-triazol-4-yl)phenol |
|---|---|
| PubChem CID | 166586731 |
| Molecular Formula | C22H24FN7O |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[6-[[(1R,3S,4S,5R)-4-fluoro-1,8-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]pyridazin-3-yl]-5-(1,2,4-triazol-4-yl)phenol |
| SMILES | CN(c1ccc(-c2ccc(-n3cnnc3)cc2O)nn1)[C@H]1C[C@]2(C)C=C[C@H]([C@H]1F)N2C |
| InChI | InChI=1S/C22H24FN7O/c1-22-9-8-17(29(22)3)21(23)18(11-22)28(2)20-7-6-16(26-27-20)15-5-4-14(10-19(15)31)30-12-24-25-13-30/h4-10,12-13,17-18,21,31H,11H2,1-3H3/t17-,18+,21-,22+/m1/s1 |
| InChIKey | HFICZTXDZOEZSF-OSZJIOELSA-N |
| XLogP | 2.61 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|