C23H28FN7O — CID 167369848
2-[6-[[(1R,4R,5R,6S)-6-fluoro-1,2,4-trimethyl-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]pyridazin-3-yl]-5-(triazol-1-yl)phenol (PubChem CID 167369848) has the molecular formula C23H28FN7O and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-[6-[[(1R,4R,5R,6S)-6-fluoro-1,2,4-trimethyl-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]pyridazin-3-yl]-5-(triazol-1-yl)phenol.
| Compound Name | 2-[6-[[(1R,4R,5R,6S)-6-fluoro-1,2,4-trimethyl-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]pyridazin-3-yl]-5-(triazol-1-yl)phenol |
|---|---|
| PubChem CID | 167369848 |
| Molecular Formula | C23H28FN7O |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[6-[[(1R,4R,5R,6S)-6-fluoro-1,2,4-trimethyl-2-azabicyclo[2.2.2]octan-5-yl]-methylamino]pyridazin-3-yl]-5-(triazol-1-yl)phenol |
| SMILES | CN(c1ccc(-c2ccc(-n3ccnn3)cc2O)nn1)[C@H]1[C@H](F)[C@@]2(C)CC[C@]1(C)CN2C |
| InChI | InChI=1S/C23H28FN7O/c1-22-9-10-23(2,29(3)14-22)20(24)21(22)30(4)19-8-7-17(26-27-19)16-6-5-15(13-18(16)32)31-12-11-25-28-31/h5-8,11-13,20-21,32H,9-10,14H2,1-4H3/t20-,21-,22+,23+/m0/s1 |
| InChIKey | FBIPFZCQLOPXQG-MYDTUXCISA-N |
| XLogP | 3.08 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |