C23H26FN7O — CID 167449832
2-[7-[(3R,4R)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]pyrrolo[2,3-c]pyridazin-3-yl]-5-(triazol-1-yl)phenol (PubChem CID 167449832) has the molecular formula C23H26FN7O and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-[7-[(3R,4R)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]pyrrolo[2,3-c]pyridazin-3-yl]-5-(triazol-1-yl)phenol.
| Compound Name | 2-[7-[(3R,4R)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]pyrrolo[2,3-c]pyridazin-3-yl]-5-(triazol-1-yl)phenol |
|---|---|
| PubChem CID | 167449832 |
| Molecular Formula | C23H26FN7O |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-[7-[(3R,4R)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]pyrrolo[2,3-c]pyridazin-3-yl]-5-(triazol-1-yl)phenol |
| SMILES | CC1(C)C[C@@H](n2ccc3cc(-c4ccc(-n5ccnn5)cc4O)nnc32)[C@@H](F)C(C)(C)N1 |
| InChI | InChI=1S/C23H26FN7O/c1-22(2)13-18(20(24)23(3,4)28-22)30-9-7-14-11-17(26-27-21(14)30)16-6-5-15(12-19(16)32)31-10-8-25-29-31/h5-12,18,20,28,32H,13H2,1-4H3/t18-,20-/m1/s1 |
| InChIKey | QCTOSORWKBMMHL-UYAOXDASSA-N |
| XLogP | 3.81 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |