C26H34FN7O2 — CID 167449907
7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-3-[2-(methoxymethoxy)-4-(4-methyltriazol-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-c]pyridazine (PubChem CID 167449907) has the molecular formula C26H34FN7O2 and a molecular weight of 495.60 g/mol. Its IUPAC name is 7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-3-[2-(methoxymethoxy)-4-(4-methyltriazol-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-c]pyridazine.
| Compound Name | 7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-3-[2-(methoxymethoxy)-4-(4-methyltriazol-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-c]pyridazine |
|---|---|
| PubChem CID | 167449907 |
| Molecular Formula | C26H34FN7O2 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-3-[2-(methoxymethoxy)-4-(4-methyltriazol-1-yl)phenyl]-5,6-dihydropyrrolo[2,3-c]pyridazine |
| SMILES | COCOc1cc(-n2cc(C)nn2)ccc1-c1cc2c(nn1)N([C@H]1CC(C)(C)NC(C)(C)[C@H]1F)CC2 |
| InChI | InChI=1S/C26H34FN7O2/c1-16-14-34(32-28-16)18-7-8-19(22(12-18)36-15-35-6)20-11-17-9-10-33(24(17)30-29-20)21-13-25(2,3)31-26(4,5)23(21)27/h7-8,11-12,14,21,23,31H,9-10,13,15H2,1-6H3/t21-,23-/m0/s1 |
| InChIKey | GYDFMXBWERKBRN-GMAHTHKFSA-N |
| XLogP | 3.64 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|