C22H29N5O3 — CID 156699219
3-(methoxymethoxy)-4-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-5-yl]phenol (PubChem CID 156699219) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-(methoxymethoxy)-4-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-5-yl]phenol.
| Compound Name | 3-(methoxymethoxy)-4-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-5-yl]phenol |
|---|---|
| PubChem CID | 156699219 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-(methoxymethoxy)-4-[1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[3,4-c]pyridazin-5-yl]phenol |
| SMILES | COCOc1cc(O)ccc1-c1cc2cnn(C3CC(C)(C)NC(C)(C)C3)c2nn1 |
| InChI | InChI=1S/C22H29N5O3/c1-21(2)10-15(11-22(3,4)26-21)27-20-14(12-23-27)8-18(24-25-20)17-7-6-16(28)9-19(17)30-13-29-5/h6-9,12,15,26,28H,10-11,13H2,1-5H3 |
| InChIKey | AUCATVOORQUENE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|