C24H28FN5O2S2 — CID 175988226
[6-[7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-2-methylsulfanyl-1,3-benzothiazol-5-yl] formate (PubChem CID 175988226) has the molecular formula C24H28FN5O2S2 and a molecular weight of 501.65 g/mol. Its IUPAC name is [6-[7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-2-methylsulfanyl-1,3-benzothiazol-5-yl] formate.
| Compound Name | [6-[7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-2-methylsulfanyl-1,3-benzothiazol-5-yl] formate |
|---|---|
| PubChem CID | 175988226 |
| Molecular Formula | C24H28FN5O2S2 |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | [6-[7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-2-methylsulfanyl-1,3-benzothiazol-5-yl] formate |
| SMILES | CSc1nc2cc(OC=O)c(-c3cc4c(nn3)N([C@H]3CC(C)(C)NC(C)(C)[C@H]3F)CC4)cc2s1 |
| InChI | InChI=1S/C24H28FN5O2S2/c1-23(2)11-17(20(25)24(3,4)29-23)30-7-6-13-8-15(27-28-21(13)30)14-9-19-16(10-18(14)32-12-31)26-22(33-5)34-19/h8-10,12,17,20,29H,6-7,11H2,1-5H3/t17-,20-/m0/s1 |
| InChIKey | AUCKGXRPXVRJAR-PXNSSMCTSA-N |
| XLogP | 4.63 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|