C25H30FN5O — CID 170630055
7-[7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-2-methylquinolin-6-ol (PubChem CID 170630055) has the molecular formula C25H30FN5O and a molecular weight of 435.55 g/mol. Its IUPAC name is 7-[7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-2-methylquinolin-6-ol.
| Compound Name | 7-[7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-2-methylquinolin-6-ol |
|---|---|
| PubChem CID | 170630055 |
| Molecular Formula | C25H30FN5O |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 7-[7-[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]-5,6-dihydropyrrolo[2,3-c]pyridazin-3-yl]-2-methylquinolin-6-ol |
| SMILES | Cc1ccc2cc(O)c(-c3cc4c(nn3)N([C@H]3CC(C)(C)NC(C)(C)[C@H]3F)CC4)cc2n1 |
| InChI | InChI=1S/C25H30FN5O/c1-14-6-7-15-11-21(32)17(12-18(15)27-14)19-10-16-8-9-31(23(16)29-28-19)20-13-24(2,3)30-25(4,5)22(20)26/h6-7,10-12,20,22,30,32H,8-9,13H2,1-5H3/t20-,22-/m0/s1 |
| InChIKey | GRDPBIDDZFTNBL-UNMCSNQZSA-N |
| XLogP | 4.33 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |