C24H27FN6O — CID 162778049
2-[3-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-imidazol-1-ylphenol (PubChem CID 162778049) has the molecular formula C24H27FN6O and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-[3-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-imidazol-1-ylphenol.
| Compound Name | 2-[3-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-imidazol-1-ylphenol |
|---|---|
| PubChem CID | 162778049 |
| Molecular Formula | C24H27FN6O |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-[3-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-imidazol-1-ylphenol |
| SMILES | C=C(c1ncc(-c2ccc(-n3ccnc3)cc2O)nn1)[C@@H]1C[C@@]2(C)CCC[C@](C)(N2)[C@@H]1F |
| InChI | InChI=1S/C24H27FN6O/c1-15(18-12-23(2)7-4-8-24(3,30-23)21(18)25)22-27-13-19(28-29-22)17-6-5-16(11-20(17)32)31-10-9-26-14-31/h5-6,9-11,13-14,18,21,30,32H,1,4,7-8,12H2,2-3H3/t18-,21+,23+,24-/m0/s1 |
| InChIKey | DFXUKGLXZAAIAE-DAQNBYSMSA-N |
| XLogP | 4.09 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |