C25H28FN5O — CID 167306030
2-[6-[1-[(1R,2R,3S,5R)-2-fluoro-1,5-dimethyl-3-bicyclo[3.3.1]nonanyl]ethenyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol (PubChem CID 167306030) has the molecular formula C25H28FN5O and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-[6-[1-[(1R,2R,3S,5R)-2-fluoro-1,5-dimethyl-3-bicyclo[3.3.1]nonanyl]ethenyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol.
| Compound Name | 2-[6-[1-[(1R,2R,3S,5R)-2-fluoro-1,5-dimethyl-3-bicyclo[3.3.1]nonanyl]ethenyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol |
|---|---|
| PubChem CID | 167306030 |
| Molecular Formula | C25H28FN5O |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 2-[6-[1-[(1R,2R,3S,5R)-2-fluoro-1,5-dimethyl-3-bicyclo[3.3.1]nonanyl]ethenyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol |
| SMILES | C=C(c1cnc(-c2ccc(-n3ccnc3)cc2O)nn1)[C@@H]1C[C@@]2(C)CCC[C@](C)(C2)[C@@H]1F |
| InChI | InChI=1S/C25H28FN5O/c1-16(19-12-24(2)7-4-8-25(3,14-24)22(19)26)20-13-28-23(30-29-20)18-6-5-17(11-21(18)32)31-10-9-27-15-31/h5-6,9-11,13,15,19,22,32H,1,4,7-8,12,14H2,2-3H3/t19-,22+,24+,25+/m0/s1 |
| InChIKey | ZESDCFAUVKSLHV-WUBOSGNUSA-N |
| XLogP | 5.39 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |