C23H24F2N6O2 — CID 172803535
2-[6-[1-[(1R,3R,4R,5R)-7,7-difluoro-4-methoxy-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol (PubChem CID 172803535) has the molecular formula C23H24F2N6O2 and a molecular weight of 454.48 g/mol. Its IUPAC name is 2-[6-[1-[(1R,3R,4R,5R)-7,7-difluoro-4-methoxy-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol.
| Compound Name | 2-[6-[1-[(1R,3R,4R,5R)-7,7-difluoro-4-methoxy-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol |
|---|---|
| PubChem CID | 172803535 |
| Molecular Formula | C23H24F2N6O2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-[6-[1-[(1R,3R,4R,5R)-7,7-difluoro-4-methoxy-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol |
| SMILES | C=C(c1cnc(-c2ccc(-n3ccnc3)cc2O)nn1)[C@H]1C[C@@]2(C)N[C@H](CC2(F)F)[C@@H]1OC |
| InChI | InChI=1S/C23H24F2N6O2/c1-13(16-9-22(2)23(24,25)10-17(28-22)20(16)33-3)18-11-27-21(30-29-18)15-5-4-14(8-19(15)32)31-7-6-26-12-31/h4-8,11-12,16-17,20,28,32H,1,9-10H2,2-3H3/t16-,17-,20-,22-/m1/s1 |
| InChIKey | RERHYIHBAQDERI-ZFNVSSEQSA-N |
| XLogP | 3.23 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |