C23H28N6O — CID 155047259
5-imidazol-1-yl-2-[6-[1-(2,2,6,6-tetramethylpiperidin-4-yl)ethenyl]-1,2,4-triazin-3-yl]phenol (PubChem CID 155047259) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is 5-imidazol-1-yl-2-[6-[1-(2,2,6,6-tetramethylpiperidin-4-yl)ethenyl]-1,2,4-triazin-3-yl]phenol.
| Compound Name | 5-imidazol-1-yl-2-[6-[1-(2,2,6,6-tetramethylpiperidin-4-yl)ethenyl]-1,2,4-triazin-3-yl]phenol |
|---|---|
| PubChem CID | 155047259 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 5-imidazol-1-yl-2-[6-[1-(2,2,6,6-tetramethylpiperidin-4-yl)ethenyl]-1,2,4-triazin-3-yl]phenol |
| SMILES | C=C(c1cnc(-c2ccc(-n3ccnc3)cc2O)nn1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H28N6O/c1-15(16-11-22(2,3)28-23(4,5)12-16)19-13-25-21(27-26-19)18-7-6-17(10-20(18)30)29-9-8-24-14-29/h6-10,13-14,16,28,30H,1,11-12H2,2-5H3 |
| InChIKey | CSSIDAXUBHCQBO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |