C24H27F2N5O2 — CID 166971616
2-[3-[1-[(1R,2S,5R)-5-ethyl-4,4-difluoro-2-methoxy-5-methylcyclohexyl]ethenyl]-1,2,4-triazin-6-yl]-5-imidazol-1-ylphenol (PubChem CID 166971616) has the molecular formula C24H27F2N5O2 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-[3-[1-[(1R,2S,5R)-5-ethyl-4,4-difluoro-2-methoxy-5-methylcyclohexyl]ethenyl]-1,2,4-triazin-6-yl]-5-imidazol-1-ylphenol.
| Compound Name | 2-[3-[1-[(1R,2S,5R)-5-ethyl-4,4-difluoro-2-methoxy-5-methylcyclohexyl]ethenyl]-1,2,4-triazin-6-yl]-5-imidazol-1-ylphenol |
|---|---|
| PubChem CID | 166971616 |
| Molecular Formula | C24H27F2N5O2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-[3-[1-[(1R,2S,5R)-5-ethyl-4,4-difluoro-2-methoxy-5-methylcyclohexyl]ethenyl]-1,2,4-triazin-6-yl]-5-imidazol-1-ylphenol |
| SMILES | C=C(c1ncc(-c2ccc(-n3ccnc3)cc2O)nn1)[C@H]1C[C@@](C)(CC)C(F)(F)C[C@@H]1OC |
| InChI | InChI=1S/C24H27F2N5O2/c1-5-23(3)11-18(21(33-4)12-24(23,25)26)15(2)22-28-13-19(29-30-22)17-7-6-16(10-20(17)32)31-9-8-27-14-31/h6-10,13-14,18,21,32H,2,5,11-12H2,1,3-4H3/t18-,21+,23-/m1/s1 |
| InChIKey | GYRVJUSZWVFRHN-RZFNWQHOSA-N |
| XLogP | 4.92 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |