C21H22FN7O — CID 162777997
2-[3-[1-[(1S,3R,4S)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(1,2,4-triazol-4-yl)phenol (PubChem CID 162777997) has the molecular formula C21H22FN7O and a molecular weight of 407.45 g/mol. Its IUPAC name is 2-[3-[1-[(1S,3R,4S)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(1,2,4-triazol-4-yl)phenol.
| Compound Name | 2-[3-[1-[(1S,3R,4S)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(1,2,4-triazol-4-yl)phenol |
|---|---|
| PubChem CID | 162777997 |
| Molecular Formula | C21H22FN7O |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-[3-[1-[(1S,3R,4S)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(1,2,4-triazol-4-yl)phenol |
| SMILES | C=C(c1ncc(-c2ccc(-n3cnnc3)cc2O)nn1)[C@H]1C[C@]2(C)CCC(N2)[C@H]1F |
| InChI | InChI=1S/C21H22FN7O/c1-12(15-8-21(2)6-5-16(26-21)19(15)22)20-23-9-17(27-28-20)14-4-3-13(7-18(14)30)29-10-24-25-11-29/h3-4,7,9-11,15-16,19,26,30H,1,5-6,8H2,2H3/t15-,16?,19+,21+/m1/s1 |
| InChIKey | IXLVQMPVUMKGSK-BXNNAHFWSA-N |
| XLogP | 2.71 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |