C21H23FN8O — CID 162777899
2-[3-[1-[(1S,2S,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(5-methyltetrazol-2-yl)phenol (PubChem CID 162777899) has the molecular formula C21H23FN8O and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-[3-[1-[(1S,2S,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(5-methyltetrazol-2-yl)phenol.
| Compound Name | 2-[3-[1-[(1S,2S,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(5-methyltetrazol-2-yl)phenol |
|---|---|
| PubChem CID | 162777899 |
| Molecular Formula | C21H23FN8O |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[3-[1-[(1S,2S,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(5-methyltetrazol-2-yl)phenol |
| SMILES | C=C(c1ncc(-c2ccc(-n3nnc(C)n3)cc2O)nn1)[C@@H]1C[C@H]2CC[C@](C)(N2)[C@H]1F |
| InChI | InChI=1S/C21H23FN8O/c1-11(16-8-13-6-7-21(3,24-13)19(16)22)20-23-10-17(26-27-20)15-5-4-14(9-18(15)31)30-28-12(2)25-29-30/h4-5,9-10,13,16,19,24,31H,1,6-8H2,2-3H3/t13-,16+,19+,21+/m1/s1 |
| InChIKey | ZJTNFGYQVFHJML-CCNVXBGZSA-N |
| XLogP | 2.41 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |