C22H22F2N6O — CID 162777784
2-[3-[1-[(1S,3R,4S,5R)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(4-fluoropyrazol-1-yl)phenol (PubChem CID 162777784) has the molecular formula C22H22F2N6O and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[3-[1-[(1S,3R,4S,5R)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(4-fluoropyrazol-1-yl)phenol.
| Compound Name | 2-[3-[1-[(1S,3R,4S,5R)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(4-fluoropyrazol-1-yl)phenol |
|---|---|
| PubChem CID | 162777784 |
| Molecular Formula | C22H22F2N6O |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-[3-[1-[(1S,3R,4S,5R)-4-fluoro-1-methyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(4-fluoropyrazol-1-yl)phenol |
| SMILES | C=C(c1ncc(-c2ccc(-n3cc(F)cn3)cc2O)nn1)[C@H]1C[C@]2(C)CC[C@@H](N2)[C@H]1F |
| InChI | InChI=1S/C22H22F2N6O/c1-12(16-8-22(2)6-5-17(27-22)20(16)24)21-25-10-18(28-29-21)15-4-3-14(7-19(15)31)30-11-13(23)9-26-30/h3-4,7,9-11,16-17,20,27,31H,1,5-6,8H2,2H3/t16-,17-,20+,22+/m1/s1 |
| InChIKey | NTALGOVFSWRWJT-ODHOGUPTSA-N |
| XLogP | 3.45 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |