C21H21F2N7O — CID 162777857
2-[3-[[(1R,2S,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]-1,2,4-triazin-6-yl]-5-(4-fluoropyrazol-1-yl)phenol (PubChem CID 162777857) has the molecular formula C21H21F2N7O and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-[3-[[(1R,2S,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]-1,2,4-triazin-6-yl]-5-(4-fluoropyrazol-1-yl)phenol.
| Compound Name | 2-[3-[[(1R,2S,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]-1,2,4-triazin-6-yl]-5-(4-fluoropyrazol-1-yl)phenol |
|---|---|
| PubChem CID | 162777857 |
| Molecular Formula | C21H21F2N7O |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[3-[[(1R,2S,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]-1,2,4-triazin-6-yl]-5-(4-fluoropyrazol-1-yl)phenol |
| SMILES | CN(c1ncc(-c2ccc(-n3cc(F)cn3)cc2O)nn1)[C@H]1C[C@@H]2C=C[C@@](C)(N2)[C@H]1F |
| InChI | InChI=1S/C21H21F2N7O/c1-21-6-5-13(26-21)7-17(19(21)23)29(2)20-24-10-16(27-28-20)15-4-3-14(8-18(15)31)30-11-12(22)9-25-30/h3-6,8-11,13,17,19,26,31H,7H2,1-2H3/t13-,17-,19-,21+/m0/s1 |
| InChIKey | GUGUBFWKSBDPLI-ANFFJROASA-N |
| XLogP | 2.40 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|