C22H23F2N5O — CID 167305369
2-[6-[(E)-[(2R,3S,5S)-3-ethyl-2,5-difluoro-3-methylcyclohexylidene]methyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol (PubChem CID 167305369) has the molecular formula C22H23F2N5O and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[6-[(E)-[(2R,3S,5S)-3-ethyl-2,5-difluoro-3-methylcyclohexylidene]methyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol.
| Compound Name | 2-[6-[(E)-[(2R,3S,5S)-3-ethyl-2,5-difluoro-3-methylcyclohexylidene]methyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol |
|---|---|
| PubChem CID | 167305369 |
| Molecular Formula | C22H23F2N5O |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-[6-[(E)-[(2R,3S,5S)-3-ethyl-2,5-difluoro-3-methylcyclohexylidene]methyl]-1,2,4-triazin-3-yl]-5-imidazol-1-ylphenol |
| SMILES | CC[C@@]1(C)C[C@H](F)C/C(=C\c2cnc(-c3ccc(-n4ccnc4)cc3O)nn2)[C@@H]1F |
| InChI | InChI=1S/C22H23F2N5O/c1-3-22(2)11-15(23)8-14(20(22)24)9-16-12-26-21(28-27-16)18-5-4-17(10-19(18)30)29-7-6-25-13-29/h4-7,9-10,12-13,15,20,30H,3,8,11H2,1-2H3/b14-9+/t15-,20+,22+/m1/s1 |
| InChIKey | ZRVONVZHQXIOPC-JFXFDMHTSA-N |
| XLogP | 4.70 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |