C24H26FN7OS — CID 167319028
2-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(6-methylsulfanylpyridazin-4-yl)phenol (PubChem CID 167319028) has the molecular formula C24H26FN7OS and a molecular weight of 479.59 g/mol. Its IUPAC name is 2-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(6-methylsulfanylpyridazin-4-yl)phenol.
| Compound Name | 2-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(6-methylsulfanylpyridazin-4-yl)phenol |
|---|---|
| PubChem CID | 167319028 |
| Molecular Formula | C24H26FN7OS |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 2-[3-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]amino]-1,2,4-triazin-6-yl]-5-(6-methylsulfanylpyridazin-4-yl)phenol |
| SMILES | CSc1cc(-c2ccc(-c3cnc(N(C4CC4)[C@@H]4C[C@@H]5CC[C@H](N5)[C@@H]4F)nn3)c(O)c2)cnn1 |
| InChI | InChI=1S/C24H26FN7OS/c1-34-22-9-14(11-27-30-22)13-2-6-17(21(33)8-13)19-12-26-24(31-29-19)32(16-4-5-16)20-10-15-3-7-18(28-15)23(20)25/h2,6,8-9,11-12,15-16,18,20,23,28,33H,3-5,7,10H2,1H3/t15-,18-,20+,23-/m0/s1 |
| InChIKey | OCNXVTWQSKRDGC-NRLYLRGFSA-N |
| XLogP | 3.62 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |