C29H36N2O2 — CID 157026534
(R)-(1,3-dimethylazetidin-3-yl)-[5-(2-phenylmethoxyethyl)-3-pyridinyl]-(4-propan-2-ylphenyl)methanol (PubChem CID 157026534) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is (R)-(1,3-dimethylazetidin-3-yl)-[5-(2-phenylmethoxyethyl)-3-pyridinyl]-(4-propan-2-ylphenyl)methanol.
| Compound Name | (R)-(1,3-dimethylazetidin-3-yl)-[5-(2-phenylmethoxyethyl)-3-pyridinyl]-(4-propan-2-ylphenyl)methanol |
|---|---|
| PubChem CID | 157026534 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | (R)-(1,3-dimethylazetidin-3-yl)-[5-(2-phenylmethoxyethyl)-3-pyridinyl]-(4-propan-2-ylphenyl)methanol |
| SMILES | CC(C)c1ccc([C@](O)(c2cncc(CCOCc3ccccc3)c2)C2(C)CN(C)C2)cc1 |
| InChI | InChI=1S/C29H36N2O2/c1-22(2)25-10-12-26(13-11-25)29(32,28(3)20-31(4)21-28)27-16-24(17-30-18-27)14-15-33-19-23-8-6-5-7-9-23/h5-13,16-18,22,32H,14-15,19-21H2,1-4H3/t29-/m0/s1 |
| InChIKey | MVNGPXXKJPPSHI-LJAQVGFWSA-N |
| XLogP | 5.15 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|