C22H26N2O — CID 157026271
(R)-(1,3-dimethylazetidin-3-yl)-(5-ethynyl-3-pyridinyl)-(4-propan-2-ylphenyl)methanol (PubChem CID 157026271) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (R)-(1,3-dimethylazetidin-3-yl)-(5-ethynyl-3-pyridinyl)-(4-propan-2-ylphenyl)methanol.
| Compound Name | (R)-(1,3-dimethylazetidin-3-yl)-(5-ethynyl-3-pyridinyl)-(4-propan-2-ylphenyl)methanol |
|---|---|
| PubChem CID | 157026271 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (R)-(1,3-dimethylazetidin-3-yl)-(5-ethynyl-3-pyridinyl)-(4-propan-2-ylphenyl)methanol |
| SMILES | C#Cc1cncc([C@@](O)(c2ccc(C(C)C)cc2)C2(C)CN(C)C2)c1 |
| InChI | InChI=1S/C22H26N2O/c1-6-17-11-20(13-23-12-17)22(25,21(4)14-24(5)15-21)19-9-7-18(8-10-19)16(2)3/h1,7-13,16,25H,14-15H2,2-5H3/t22-/m0/s1 |
| InChIKey | KPFMMWLGQDKKOX-QFIPXVFZSA-N |
| XLogP | 3.37 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|