C26H29N3O2 — CID 166525408
3-[2-[5-[(R)-(1,3-dimethylazetidin-3-yl)-hydroxy-(4-propan-2-ylphenyl)methyl]-3-pyridinyl]ethynyl]pyrrol-3-ol (PubChem CID 166525408) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[2-[5-[(R)-(1,3-dimethylazetidin-3-yl)-hydroxy-(4-propan-2-ylphenyl)methyl]-3-pyridinyl]ethynyl]pyrrol-3-ol.
| Compound Name | 3-[2-[5-[(R)-(1,3-dimethylazetidin-3-yl)-hydroxy-(4-propan-2-ylphenyl)methyl]-3-pyridinyl]ethynyl]pyrrol-3-ol |
|---|---|
| PubChem CID | 166525408 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[2-[5-[(R)-(1,3-dimethylazetidin-3-yl)-hydroxy-(4-propan-2-ylphenyl)methyl]-3-pyridinyl]ethynyl]pyrrol-3-ol |
| SMILES | CC(C)c1ccc([C@](O)(c2cncc(C#CC3(O)C=CN=C3)c2)C2(C)CN(C)C2)cc1 |
| InChI | InChI=1S/C26H29N3O2/c1-19(2)21-5-7-22(8-6-21)26(31,24(3)17-29(4)18-24)23-13-20(14-28-15-23)9-10-25(30)11-12-27-16-25/h5-8,11-16,19,30-31H,17-18H2,1-4H3/t25?,26-/m0/s1 |
| InChIKey | LHJKYWMVOYKOAQ-AMVUTOCUSA-N |
| XLogP | 3.07 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|