C24H30N2O2 — CID 175382685
4-[5-[(1,3-dimethylazetidin-3-yl)-hydroxy-(4-propan-2-ylphenyl)methyl]-3-pyridinyl]but-3-yn-1-ol (PubChem CID 175382685) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-[5-[(1,3-dimethylazetidin-3-yl)-hydroxy-(4-propan-2-ylphenyl)methyl]-3-pyridinyl]but-3-yn-1-ol.
| Compound Name | 4-[5-[(1,3-dimethylazetidin-3-yl)-hydroxy-(4-propan-2-ylphenyl)methyl]-3-pyridinyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 175382685 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-[5-[(1,3-dimethylazetidin-3-yl)-hydroxy-(4-propan-2-ylphenyl)methyl]-3-pyridinyl]but-3-yn-1-ol |
| SMILES | CC(C)c1ccc(C(O)(c2cncc(C#CCCO)c2)C2(C)CN(C)C2)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-18(2)20-8-10-21(11-9-20)24(28,23(3)16-26(4)17-23)22-13-19(14-25-15-22)7-5-6-12-27/h8-11,13-15,18,27-28H,6,12,16-17H2,1-4H3 |
| InChIKey | YJXUMRQJNNPKFZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|