C24H28F6N8O3 — CID 157030629
N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-2-(3-fluoropropyl)-1,2,4-triazole-3-carboxamide (PubChem CID 157030629) has the molecular formula C24H28F6N8O3 and a molecular weight of 590.53 g/mol. Its IUPAC name is N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-2-(3-fluoropropyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-2-(3-fluoropropyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 157030629 |
| Molecular Formula | C24H28F6N8O3 |
| Molecular Weight | 590.53 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-2-(3-fluoropropyl)-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(CCC(F)(F)F)N[C@H](O)c1cnn2cc([C@@H](NC(=O)c3ncnn3CCCF)C3CCC(F)(F)CC3)nc2c1 |
| InChI | InChI=1S/C24H28F6N8O3/c25-8-1-9-37-20(31-13-33-37)22(41)36-19(14-2-5-23(26,27)6-3-14)16-12-38-17(34-16)10-15(11-32-38)21(40)35-18(39)4-7-24(28,29)30/h10-14,19,21,40H,1-9H2,(H,35,39)(H,36,41)/t19-,21+/m0/s1 |
| InChIKey | LFAGMOWYOWMWIB-PZJWPPBQSA-N |
| XLogP | 3.43 |
| TPSA | 139.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|