C26H27F7N6O3 — CID 157030690
N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-5-(2,2-difluoroethyl)pyridine-3-carboxamide (PubChem CID 157030690) has the molecular formula C26H27F7N6O3 and a molecular weight of 604.53 g/mol. Its IUPAC name is N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-5-(2,2-difluoroethyl)pyridine-3-carboxamide.
| Compound Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-5-(2,2-difluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 157030690 |
| Molecular Formula | C26H27F7N6O3 |
| Molecular Weight | 604.53 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[(R)-hydroxy-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-5-(2,2-difluoroethyl)pyridine-3-carboxamide |
| SMILES | O=C(CCC(F)(F)F)N[C@H](O)c1cnn2cc([C@@H](NC(=O)c3cncc(CC(F)F)c3)C3CCC(F)(F)CC3)nc2c1 |
| InChI | InChI=1S/C26H27F7N6O3/c27-19(28)8-14-7-16(11-34-10-14)24(42)38-22(15-1-4-25(29,30)5-2-15)18-13-39-20(36-18)9-17(12-35-39)23(41)37-21(40)3-6-26(31,32)33/h7,9-13,15,19,22-23,41H,1-6,8H2,(H,37,40)(H,38,42)/t22-,23+/m0/s1 |
| InChIKey | YWJKFEDQDIVJJM-XZOQPEGZSA-N |
| XLogP | 4.68 |
| TPSA | 121.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|