C30H33F7N6O2 — CID 167245069
N-[(S)-[7-[cyclopropyl-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]-(4,4-difluorocyclohexyl)methyl]-5-(3,3-difluoropropyl)pyridine-3-carboxamide (PubChem CID 167245069) has the molecular formula C30H33F7N6O2 and a molecular weight of 642.62 g/mol. Its IUPAC name is N-[(S)-[7-[cyclopropyl-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]-(4,4-difluorocyclohexyl)methyl]-5-(3,3-difluoropropyl)pyridine-3-carboxamide.
| Compound Name | N-[(S)-[7-[cyclopropyl-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]-(4,4-difluorocyclohexyl)methyl]-5-(3,3-difluoropropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167245069 |
| Molecular Formula | C30H33F7N6O2 |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | N-[(S)-[7-[cyclopropyl-(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]-(4,4-difluorocyclohexyl)methyl]-5-(3,3-difluoropropyl)pyridine-3-carboxamide |
| SMILES | O=C(CCC(F)(F)F)NC(c1cnn2cc([C@@H](NC(=O)c3cncc(CCC(F)F)c3)C3CCC(F)(F)CC3)nc2c1)C1CC1 |
| InChI | InChI=1S/C30H33F7N6O2/c31-23(32)4-1-17-11-21(14-38-13-17)28(45)42-27(19-5-8-29(33,34)9-6-19)22-16-43-24(40-22)12-20(15-39-43)26(18-2-3-18)41-25(44)7-10-30(35,36)37/h11-16,18-19,23,26-27H,1-10H2,(H,41,44)(H,42,45)/t26?,27-/m0/s1 |
| InChIKey | JZZDYHIJZIECOJ-GEVKEYJPSA-N |
| XLogP | 6.53 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |